C14H20BrN — CID 144768200
N-[(1E,4Z)-6-bromo-2-methyl-3-methylidenehepta-1,4,6-trienyl]prop-2-en-1-imine;ethane (PubChem CID 144768200) has the molecular formula C14H20BrN and a molecular weight of 282.23 g/mol. Its IUPAC name is N-[(1E,4Z)-6-bromo-2-methyl-3-methylidenehepta-1,4,6-trienyl]prop-2-en-1-imine;ethane.
| Compound Name | N-[(1E,4Z)-6-bromo-2-methyl-3-methylidenehepta-1,4,6-trienyl]prop-2-en-1-imine;ethane |
|---|---|
| PubChem CID | 144768200 |
| Molecular Formula | C14H20BrN |
| Molecular Weight | 282.23 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | N-[(1E,4Z)-6-bromo-2-methyl-3-methylidenehepta-1,4,6-trienyl]prop-2-en-1-imine;ethane |
| SMILES | C=C/C=N/C=C(\C)C(=C)/C=C\C(=C)Br.CC |
| InChI | InChI=1S/C12H14BrN.C2H6/c1-5-8-14-9-11(3)10(2)6-7-12(4)13;1-2/h5-9H,1-2,4H2,3H3;1-2H3/b7-6-,11-9+,14-8+; |
| InChIKey | GMPKZFJNQNYQCI-YVSOXBNPSA-N |
| XLogP | 5.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.23 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|