C12H14BrN — CID 144768201
N-[(1E,4Z)-6-bromo-2-methyl-3-methylidenehepta-1,4,6-trienyl]prop-2-en-1-imine (PubChem CID 144768201) has the molecular formula C12H14BrN and a molecular weight of 252.15 g/mol. Its IUPAC name is N-[(1E,4Z)-6-bromo-2-methyl-3-methylidenehepta-1,4,6-trienyl]prop-2-en-1-imine.
| Compound Name | N-[(1E,4Z)-6-bromo-2-methyl-3-methylidenehepta-1,4,6-trienyl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 144768201 |
| Molecular Formula | C12H14BrN |
| Molecular Weight | 252.15 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | N-[(1E,4Z)-6-bromo-2-methyl-3-methylidenehepta-1,4,6-trienyl]prop-2-en-1-imine |
| SMILES | C=C/C=N/C=C(\C)C(=C)/C=C\C(=C)Br |
| InChI | InChI=1S/C12H14BrN/c1-5-8-14-9-11(3)10(2)6-7-12(4)13/h5-9H,1-2,4H2,3H3/b7-6-,11-9+,14-8+ |
| InChIKey | XMCFQPPFUCYPNP-PVRZDCSNSA-N |
| XLogP | 4.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.15 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|