About iminoazanium;4-(3-methylbut-1-ynyl)aniline
iminoazanium;4-(3-methylbut-1-ynyl)aniline (PubChem CID 144768561) has the molecular formula C11H16N3+
and a molecular weight of 190.27 g/mol. Its IUPAC name is iminoazanium;4-(3-methylbut-1-ynyl)aniline.
Molecular Properties
| Compound Name | iminoazanium;4-(3-methylbut-1-ynyl)aniline |
| PubChem CID | 144768561 |
| Molecular Formula | C11H16N3+ |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | iminoazanium;4-(3-methylbut-1-ynyl)aniline |
| SMILES | CC(C)C#Cc1ccc(N)cc1.[H]N=[NH2+] |
| InChI | InChI=1S/C11H13N.H2N2/c1-9(2)3-4-10-5-7-11(12)8-6-10;1-2/h5-9H,12H2,1-2H3;1-2H/p+1 |
| InChIKey | JRHIOIWMTTZXKY-UHFFFAOYSA-O |
| XLogP | 1.05 |
| TPSA | 75.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze iminoazanium;4-(3-methylbut-1-ynyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iminoazanium;4-(3-methylbut-1-ynyl)aniline?
The IUPAC name of iminoazanium;4-(3-methylbut-1-ynyl)aniline (CID 144768561) is iminoazanium;4-(3-methylbut-1-ynyl)aniline.
What is the SMILES notation for iminoazanium;4-(3-methylbut-1-ynyl)aniline?
The canonical SMILES for iminoazanium;4-(3-methylbut-1-ynyl)aniline is CC(C)C#Cc1ccc(N)cc1.[H]N=[NH2+].
What is the InChIKey of iminoazanium;4-(3-methylbut-1-ynyl)aniline?
The InChIKey is JRHIOIWMTTZXKY-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H13N.H2N2/c1-9(2)3-4-10-5-7-11(12)8-6-10;1-2/h5-9H,12H2,1-2H3;1-2H/p+1.
What are the key properties of iminoazanium;4-(3-methylbut-1-ynyl)aniline?
iminoazanium;4-(3-methylbut-1-ynyl)aniline has a molecular weight of 190.27 g/mol, XLogP of 1.05, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for iminoazanium;4-(3-methylbut-1-ynyl)aniline is sourced from PubChem (CID 144768561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).