C21H20F4O6S — CID 144768629
methyl 2-[2-(8-fluoro-5-methyl-3,4-dihydro-2H-chromen-6-yl)-6-methyl-3-(trifluoromethylsulfonyloxy)phenyl]acetate (PubChem CID 144768629) has the molecular formula C21H20F4O6S and a molecular weight of 476.44 g/mol. Its IUPAC name is methyl 2-[2-(8-fluoro-5-methyl-3,4-dihydro-2H-chromen-6-yl)-6-methyl-3-(trifluoromethylsulfonyloxy)phenyl]acetate.
| Compound Name | methyl 2-[2-(8-fluoro-5-methyl-3,4-dihydro-2H-chromen-6-yl)-6-methyl-3-(trifluoromethylsulfonyloxy)phenyl]acetate |
|---|---|
| PubChem CID | 144768629 |
| Molecular Formula | C21H20F4O6S |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | methyl 2-[2-(8-fluoro-5-methyl-3,4-dihydro-2H-chromen-6-yl)-6-methyl-3-(trifluoromethylsulfonyloxy)phenyl]acetate |
| SMILES | COC(=O)Cc1c(C)ccc(OS(=O)(=O)C(F)(F)F)c1-c1cc(F)c2c(c1C)CCCO2 |
| InChI | InChI=1S/C21H20F4O6S/c1-11-6-7-17(31-32(27,28)21(23,24)25)19(14(11)10-18(26)29-3)15-9-16(22)20-13(12(15)2)5-4-8-30-20/h6-7,9H,4-5,8,10H2,1-3H3 |
| InChIKey | GNHRRTAYYQAZIP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|