About (Z)-N-(1-fluoroethenyl)-4-methyl-3-methylidenepentan-2-imine;hydrofluoride
(Z)-N-(1-fluoroethenyl)-4-methyl-3-methylidenepentan-2-imine;hydrofluoride (PubChem CID 144768741) has the molecular formula C9H15F2N
and a molecular weight of 175.22 g/mol. Its IUPAC name is (Z)-N-(1-fluoroethenyl)-4-methyl-3-methylidenepentan-2-imine;hydrofluoride.
Molecular Properties
| Compound Name | (Z)-N-(1-fluoroethenyl)-4-methyl-3-methylidenepentan-2-imine;hydrofluoride |
| PubChem CID | 144768741 |
| Molecular Formula | C9H15F2N |
| Molecular Weight | 175.22 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | (Z)-N-(1-fluoroethenyl)-4-methyl-3-methylidenepentan-2-imine;hydrofluoride |
| SMILES | C=C(F)/N=C(/C)C(=C)C(C)C.F |
| InChI | InChI=1S/C9H14FN.FH/c1-6(2)7(3)8(4)11-9(5)10;/h6H,3,5H2,1-2,4H3;1H/b11-8-; |
| InChIKey | JJAHDHJWKVADCR-MKFZHGHUSA-N |
| XLogP | 3.25 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.22 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-(1-fluoroethenyl)-4-methyl-3-methylidenepentan-2-imine;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-(1-fluoroethenyl)-4-methyl-3-methylidenepentan-2-imine;hydrofluoride?
The IUPAC name of (Z)-N-(1-fluoroethenyl)-4-methyl-3-methylidenepentan-2-imine;hydrofluoride (CID 144768741) is (Z)-N-(1-fluoroethenyl)-4-methyl-3-methylidenepentan-2-imine;hydrofluoride.
What is the SMILES notation for (Z)-N-(1-fluoroethenyl)-4-methyl-3-methylidenepentan-2-imine;hydrofluoride?
The canonical SMILES for (Z)-N-(1-fluoroethenyl)-4-methyl-3-methylidenepentan-2-imine;hydrofluoride is C=C(F)/N=C(/C)C(=C)C(C)C.F.
What is the InChIKey of (Z)-N-(1-fluoroethenyl)-4-methyl-3-methylidenepentan-2-imine;hydrofluoride?
The InChIKey is JJAHDHJWKVADCR-MKFZHGHUSA-N. The full InChI is InChI=1S/C9H14FN.FH/c1-6(2)7(3)8(4)11-9(5)10;/h6H,3,5H2,1-2,4H3;1H/b11-8-;.
What are the key properties of (Z)-N-(1-fluoroethenyl)-4-methyl-3-methylidenepentan-2-imine;hydrofluoride?
(Z)-N-(1-fluoroethenyl)-4-methyl-3-methylidenepentan-2-imine;hydrofluoride has a molecular weight of 175.22 g/mol, XLogP of 3.25, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-(1-fluoroethenyl)-4-methyl-3-methylidenepentan-2-imine;hydrofluoride is sourced from PubChem (CID 144768741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).