C13H16FN — CID 144769687
(2Z,4E,5Z)-N,3-bis(ethenyl)-4-ethylidene-2-fluorohepta-2,5-dien-1-imine (PubChem CID 144769687) has the molecular formula C13H16FN and a molecular weight of 205.28 g/mol. Its IUPAC name is (2Z,4E,5Z)-N,3-bis(ethenyl)-4-ethylidene-2-fluorohepta-2,5-dien-1-imine.
| Compound Name | (2Z,4E,5Z)-N,3-bis(ethenyl)-4-ethylidene-2-fluorohepta-2,5-dien-1-imine |
|---|---|
| PubChem CID | 144769687 |
| Molecular Formula | C13H16FN |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | (2Z,4E,5Z)-N,3-bis(ethenyl)-4-ethylidene-2-fluorohepta-2,5-dien-1-imine |
| SMILES | C=C/N=C/C(F)=C(C=C)/C(/C=C\C)=C/C |
| InChI | InChI=1S/C13H16FN/c1-5-9-11(6-2)12(7-3)13(14)10-15-8-4/h5-10H,3-4H2,1-2H3/b9-5-,11-6+,13-12-,15-10+ |
| InChIKey | QEJJLAJZQXKBOF-RMDIXWPHSA-N |
| XLogP | 4.13 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|