About ethene;[(3E)-5-ethenyl-6-methylhepta-1,3,5-trien-4-yl] N-methylcarbamate
ethene;[(3E)-5-ethenyl-6-methylhepta-1,3,5-trien-4-yl] N-methylcarbamate (PubChem CID 144769843) has the molecular formula C14H21NO2
and a molecular weight of 235.33 g/mol. Its IUPAC name is ethene;[(3E)-5-ethenyl-6-methylhepta-1,3,5-trien-4-yl] N-methylcarbamate.
Molecular Properties
| Compound Name | ethene;[(3E)-5-ethenyl-6-methylhepta-1,3,5-trien-4-yl] N-methylcarbamate |
| PubChem CID | 144769843 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | ethene;[(3E)-5-ethenyl-6-methylhepta-1,3,5-trien-4-yl] N-methylcarbamate |
| SMILES | C=C.C=C/C=C(/OC(=O)NC)C(C=C)=C(C)C |
| InChI | InChI=1S/C12H17NO2.C2H4/c1-6-8-11(15-12(14)13-5)10(7-2)9(3)4;1-2/h6-8H,1-2H2,3-5H3,(H,13,14);1-2H2/b11-8+; |
| InChIKey | BCYNCOYSRZLKLS-YGCVIUNWSA-N |
| XLogP | 3.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethene;[(3E)-5-ethenyl-6-methylhepta-1,3,5-trien-4-yl] N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;[(3E)-5-ethenyl-6-methylhepta-1,3,5-trien-4-yl] N-methylcarbamate?
The IUPAC name of ethene;[(3E)-5-ethenyl-6-methylhepta-1,3,5-trien-4-yl] N-methylcarbamate (CID 144769843) is ethene;[(3E)-5-ethenyl-6-methylhepta-1,3,5-trien-4-yl] N-methylcarbamate.
What is the SMILES notation for ethene;[(3E)-5-ethenyl-6-methylhepta-1,3,5-trien-4-yl] N-methylcarbamate?
The canonical SMILES for ethene;[(3E)-5-ethenyl-6-methylhepta-1,3,5-trien-4-yl] N-methylcarbamate is C=C.C=C/C=C(/OC(=O)NC)C(C=C)=C(C)C.
What is the InChIKey of ethene;[(3E)-5-ethenyl-6-methylhepta-1,3,5-trien-4-yl] N-methylcarbamate?
The InChIKey is BCYNCOYSRZLKLS-YGCVIUNWSA-N. The full InChI is InChI=1S/C12H17NO2.C2H4/c1-6-8-11(15-12(14)13-5)10(7-2)9(3)4;1-2/h6-8H,1-2H2,3-5H3,(H,13,14);1-2H2/b11-8+;.
What are the key properties of ethene;[(3E)-5-ethenyl-6-methylhepta-1,3,5-trien-4-yl] N-methylcarbamate?
ethene;[(3E)-5-ethenyl-6-methylhepta-1,3,5-trien-4-yl] N-methylcarbamate has a molecular weight of 235.33 g/mol, XLogP of 3.74, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;[(3E)-5-ethenyl-6-methylhepta-1,3,5-trien-4-yl] N-methylcarbamate is sourced from PubChem (CID 144769843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).