C19H29IO3S — CID 144770418
(10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl)oxysulfanyl hypoiodite (PubChem CID 144770418) has the molecular formula C19H29IO3S and a molecular weight of 464.41 g/mol. Its IUPAC name is (10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl)oxysulfanyl hypoiodite.
| Compound Name | (10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl)oxysulfanyl hypoiodite |
|---|---|
| PubChem CID | 144770418 |
| Molecular Formula | C19H29IO3S |
| Molecular Weight | 464.41 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | (10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl)oxysulfanyl hypoiodite |
| SMILES | CC12CCC3C(CCC4CC(OSOI)CCC43C)C1CCC2=O |
| InChI | InChI=1S/C19H29IO3S/c1-18-9-7-13(22-24-23-20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h12-16H,3-11H2,1-2H3 |
| InChIKey | CCAIJSSSGWLQLJ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.41 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|