About methanamine;3-thiophen-3-ylaniline
methanamine;3-thiophen-3-ylaniline (PubChem CID 144770494) has the molecular formula C11H14N2S
and a molecular weight of 206.31 g/mol. Its IUPAC name is methanamine;3-thiophen-3-ylaniline.
Molecular Properties
| Compound Name | methanamine;3-thiophen-3-ylaniline |
| PubChem CID | 144770494 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | methanamine;3-thiophen-3-ylaniline |
| SMILES | CN.Nc1cccc(-c2ccsc2)c1 |
| InChI | InChI=1S/C10H9NS.CH5N/c11-10-3-1-2-8(6-10)9-4-5-12-7-9;1-2/h1-7H,11H2;2H2,1H3 |
| InChIKey | IRNINZNLFPOXJX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methanamine;3-thiophen-3-ylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;3-thiophen-3-ylaniline?
The IUPAC name of methanamine;3-thiophen-3-ylaniline (CID 144770494) is methanamine;3-thiophen-3-ylaniline.
What is the SMILES notation for methanamine;3-thiophen-3-ylaniline?
The canonical SMILES for methanamine;3-thiophen-3-ylaniline is CN.Nc1cccc(-c2ccsc2)c1.
What is the InChIKey of methanamine;3-thiophen-3-ylaniline?
The InChIKey is IRNINZNLFPOXJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NS.CH5N/c11-10-3-1-2-8(6-10)9-4-5-12-7-9;1-2/h1-7H,11H2;2H2,1H3.
What are the key properties of methanamine;3-thiophen-3-ylaniline?
methanamine;3-thiophen-3-ylaniline has a molecular weight of 206.31 g/mol, XLogP of 2.57, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;3-thiophen-3-ylaniline is sourced from PubChem (CID 144770494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).