About (3Z)-4-ethenoxy-3-(trifluoromethyl)penta-1,3-diene
(3Z)-4-ethenoxy-3-(trifluoromethyl)penta-1,3-diene (PubChem CID 144770641) has the molecular formula C8H9F3O
and a molecular weight of 178.15 g/mol. Its IUPAC name is (3Z)-4-ethenoxy-3-(trifluoromethyl)penta-1,3-diene.
Molecular Properties
| Compound Name | (3Z)-4-ethenoxy-3-(trifluoromethyl)penta-1,3-diene |
| PubChem CID | 144770641 |
| Molecular Formula | C8H9F3O |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | (3Z)-4-ethenoxy-3-(trifluoromethyl)penta-1,3-diene |
| SMILES | C=CO/C(C)=C(/C=C)C(F)(F)F |
| InChI | InChI=1S/C8H9F3O/c1-4-7(8(9,10)11)6(3)12-5-2/h4-5H,1-2H2,3H3/b7-6- |
| InChIKey | ZQIXVIUAKGUWFD-SREVYHEPSA-N |
| XLogP | 3.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-4-ethenoxy-3-(trifluoromethyl)penta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-4-ethenoxy-3-(trifluoromethyl)penta-1,3-diene?
The IUPAC name of (3Z)-4-ethenoxy-3-(trifluoromethyl)penta-1,3-diene (CID 144770641) is (3Z)-4-ethenoxy-3-(trifluoromethyl)penta-1,3-diene.
What is the SMILES notation for (3Z)-4-ethenoxy-3-(trifluoromethyl)penta-1,3-diene?
The canonical SMILES for (3Z)-4-ethenoxy-3-(trifluoromethyl)penta-1,3-diene is C=CO/C(C)=C(/C=C)C(F)(F)F.
What is the InChIKey of (3Z)-4-ethenoxy-3-(trifluoromethyl)penta-1,3-diene?
The InChIKey is ZQIXVIUAKGUWFD-SREVYHEPSA-N. The full InChI is InChI=1S/C8H9F3O/c1-4-7(8(9,10)11)6(3)12-5-2/h4-5H,1-2H2,3H3/b7-6-.
What are the key properties of (3Z)-4-ethenoxy-3-(trifluoromethyl)penta-1,3-diene?
(3Z)-4-ethenoxy-3-(trifluoromethyl)penta-1,3-diene has a molecular weight of 178.15 g/mol, XLogP of 3.17, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-4-ethenoxy-3-(trifluoromethyl)penta-1,3-diene is sourced from PubChem (CID 144770641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).