About tert-butyl N-[[(4Z,5E)-4-ethylidene-5-prop-2-enylidenefuran-2-yl]methyl]carbamate
tert-butyl N-[[(4Z,5E)-4-ethylidene-5-prop-2-enylidenefuran-2-yl]methyl]carbamate (PubChem CID 144770845) has the molecular formula C15H21NO3
and a molecular weight of 263.34 g/mol. Its IUPAC name is tert-butyl N-[[(4Z,5E)-4-ethylidene-5-prop-2-enylidenefuran-2-yl]methyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[[(4Z,5E)-4-ethylidene-5-prop-2-enylidenefuran-2-yl]methyl]carbamate |
| PubChem CID | 144770845 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | tert-butyl N-[[(4Z,5E)-4-ethylidene-5-prop-2-enylidenefuran-2-yl]methyl]carbamate |
| SMILES | C=C/C=c1/oc(CNC(=O)OC(C)(C)C)c/c1=C/C |
| InChI | InChI=1S/C15H21NO3/c1-6-8-13-11(7-2)9-12(18-13)10-16-14(17)19-15(3,4)5/h6-9H,1,10H2,2-5H3,(H,16,17)/b11-7-,13-8+ |
| InChIKey | XVNIUUUYHFOABQ-JKNYEHFOSA-N |
| XLogP | 2.07 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl N-[[(4Z,5E)-4-ethylidene-5-prop-2-enylidenefuran-2-yl]methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[[(4Z,5E)-4-ethylidene-5-prop-2-enylidenefuran-2-yl]methyl]carbamate?
The IUPAC name of tert-butyl N-[[(4Z,5E)-4-ethylidene-5-prop-2-enylidenefuran-2-yl]methyl]carbamate (CID 144770845) is tert-butyl N-[[(4Z,5E)-4-ethylidene-5-prop-2-enylidenefuran-2-yl]methyl]carbamate.
What is the SMILES notation for tert-butyl N-[[(4Z,5E)-4-ethylidene-5-prop-2-enylidenefuran-2-yl]methyl]carbamate?
The canonical SMILES for tert-butyl N-[[(4Z,5E)-4-ethylidene-5-prop-2-enylidenefuran-2-yl]methyl]carbamate is C=C/C=c1/oc(CNC(=O)OC(C)(C)C)c/c1=C/C.
What is the InChIKey of tert-butyl N-[[(4Z,5E)-4-ethylidene-5-prop-2-enylidenefuran-2-yl]methyl]carbamate?
The InChIKey is XVNIUUUYHFOABQ-JKNYEHFOSA-N. The full InChI is InChI=1S/C15H21NO3/c1-6-8-13-11(7-2)9-12(18-13)10-16-14(17)19-15(3,4)5/h6-9H,1,10H2,2-5H3,(H,16,17)/b11-7-,13-8+.
What are the key properties of tert-butyl N-[[(4Z,5E)-4-ethylidene-5-prop-2-enylidenefuran-2-yl]methyl]carbamate?
tert-butyl N-[[(4Z,5E)-4-ethylidene-5-prop-2-enylidenefuran-2-yl]methyl]carbamate has a molecular weight of 263.34 g/mol, XLogP of 2.07, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[[(4Z,5E)-4-ethylidene-5-prop-2-enylidenefuran-2-yl]methyl]carbamate is sourced from PubChem (CID 144770845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).