About 2-(1,1-difluoroethyl)-4-[(2-methylpropan-2-yl)oxy]pyridine;formamide
2-(1,1-difluoroethyl)-4-[(2-methylpropan-2-yl)oxy]pyridine;formamide (PubChem CID 144770920) has the molecular formula C12H18F2N2O2
and a molecular weight of 260.28 g/mol. Its IUPAC name is 2-(1,1-difluoroethyl)-4-[(2-methylpropan-2-yl)oxy]pyridine;formamide.
Molecular Properties
| Compound Name | 2-(1,1-difluoroethyl)-4-[(2-methylpropan-2-yl)oxy]pyridine;formamide |
| PubChem CID | 144770920 |
| Molecular Formula | C12H18F2N2O2 |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 2-(1,1-difluoroethyl)-4-[(2-methylpropan-2-yl)oxy]pyridine;formamide |
| SMILES | CC(C)(C)Oc1ccnc(C(C)(F)F)c1.NC=O |
| InChI | InChI=1S/C11H15F2NO.CH3NO/c1-10(2,3)15-8-5-6-14-9(7-8)11(4,12)13;2-1-3/h5-7H,1-4H3;1H,(H2,2,3) |
| InChIKey | MAFLXFDZYNGWCC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,1-difluoroethyl)-4-[(2-methylpropan-2-yl)oxy]pyridine;formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-difluoroethyl)-4-[(2-methylpropan-2-yl)oxy]pyridine;formamide?
The IUPAC name of 2-(1,1-difluoroethyl)-4-[(2-methylpropan-2-yl)oxy]pyridine;formamide (CID 144770920) is 2-(1,1-difluoroethyl)-4-[(2-methylpropan-2-yl)oxy]pyridine;formamide.
What is the SMILES notation for 2-(1,1-difluoroethyl)-4-[(2-methylpropan-2-yl)oxy]pyridine;formamide?
The canonical SMILES for 2-(1,1-difluoroethyl)-4-[(2-methylpropan-2-yl)oxy]pyridine;formamide is CC(C)(C)Oc1ccnc(C(C)(F)F)c1.NC=O.
What is the InChIKey of 2-(1,1-difluoroethyl)-4-[(2-methylpropan-2-yl)oxy]pyridine;formamide?
The InChIKey is MAFLXFDZYNGWCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F2NO.CH3NO/c1-10(2,3)15-8-5-6-14-9(7-8)11(4,12)13;2-1-3/h5-7H,1-4H3;1H,(H2,2,3).
What are the key properties of 2-(1,1-difluoroethyl)-4-[(2-methylpropan-2-yl)oxy]pyridine;formamide?
2-(1,1-difluoroethyl)-4-[(2-methylpropan-2-yl)oxy]pyridine;formamide has a molecular weight of 260.28 g/mol, XLogP of 2.47, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-difluoroethyl)-4-[(2-methylpropan-2-yl)oxy]pyridine;formamide is sourced from PubChem (CID 144770920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).