C15H17F6N7 — CID 144771046
4-N-propyl-2-N-(1,1,1-trifluorobutan-2-yl)-6-[6-(trifluoromethyl)pyrazin-2-yl]-1,3,5-triazine-2,4-diamine (PubChem CID 144771046) has the molecular formula C15H17F6N7 and a molecular weight of 409.34 g/mol. Its IUPAC name is 4-N-propyl-2-N-(1,1,1-trifluorobutan-2-yl)-6-[6-(trifluoromethyl)pyrazin-2-yl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-propyl-2-N-(1,1,1-trifluorobutan-2-yl)-6-[6-(trifluoromethyl)pyrazin-2-yl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 144771046 |
| Molecular Formula | C15H17F6N7 |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 4-N-propyl-2-N-(1,1,1-trifluorobutan-2-yl)-6-[6-(trifluoromethyl)pyrazin-2-yl]-1,3,5-triazine-2,4-diamine |
| SMILES | CCCNc1nc(NC(CC)C(F)(F)F)nc(-c2cncc(C(F)(F)F)n2)n1 |
| InChI | InChI=1S/C15H17F6N7/c1-3-5-23-12-26-11(8-6-22-7-10(24-8)15(19,20)21)27-13(28-12)25-9(4-2)14(16,17)18/h6-7,9H,3-5H2,1-2H3,(H2,23,25,26,27,28) |
| InChIKey | XMIRIJPQBXUCPU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |