About N-naphthalen-2-ylsulfanylmethanamine;pyrrolidine
N-naphthalen-2-ylsulfanylmethanamine;pyrrolidine (PubChem CID 144771559) has the molecular formula C15H20N2S
and a molecular weight of 260.41 g/mol. Its IUPAC name is N-naphthalen-2-ylsulfanylmethanamine;pyrrolidine.
Molecular Properties
| Compound Name | N-naphthalen-2-ylsulfanylmethanamine;pyrrolidine |
| PubChem CID | 144771559 |
| Molecular Formula | C15H20N2S |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | N-naphthalen-2-ylsulfanylmethanamine;pyrrolidine |
| SMILES | C1CCNC1.CNSc1ccc2ccccc2c1 |
| InChI | InChI=1S/C11H11NS.C4H9N/c1-12-13-11-7-6-9-4-2-3-5-10(9)8-11;1-2-4-5-3-1/h2-8,12H,1H3;5H,1-4H2 |
| InChIKey | NLQZREWCNNFVBP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-naphthalen-2-ylsulfanylmethanamine;pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-naphthalen-2-ylsulfanylmethanamine;pyrrolidine?
The IUPAC name of N-naphthalen-2-ylsulfanylmethanamine;pyrrolidine (CID 144771559) is N-naphthalen-2-ylsulfanylmethanamine;pyrrolidine.
What is the SMILES notation for N-naphthalen-2-ylsulfanylmethanamine;pyrrolidine?
The canonical SMILES for N-naphthalen-2-ylsulfanylmethanamine;pyrrolidine is C1CCNC1.CNSc1ccc2ccccc2c1.
What is the InChIKey of N-naphthalen-2-ylsulfanylmethanamine;pyrrolidine?
The InChIKey is NLQZREWCNNFVBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NS.C4H9N/c1-12-13-11-7-6-9-4-2-3-5-10(9)8-11;1-2-4-5-3-1/h2-8,12H,1H3;5H,1-4H2.
What are the key properties of N-naphthalen-2-ylsulfanylmethanamine;pyrrolidine?
N-naphthalen-2-ylsulfanylmethanamine;pyrrolidine has a molecular weight of 260.41 g/mol, XLogP of 3.44, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-naphthalen-2-ylsulfanylmethanamine;pyrrolidine is sourced from PubChem (CID 144771559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).