C23H54N6 — CID 144771781
N',N'-dibutyl-1-[2-ethyl-2-(2,2,6,6-tetramethylpiperidin-4-yl)hydrazinyl]methanediamine;propan-1-amine (PubChem CID 144771781) has the molecular formula C23H54N6 and a molecular weight of 414.73 g/mol. Its IUPAC name is N',N'-dibutyl-1-[2-ethyl-2-(2,2,6,6-tetramethylpiperidin-4-yl)hydrazinyl]methanediamine;propan-1-amine.
| Compound Name | N',N'-dibutyl-1-[2-ethyl-2-(2,2,6,6-tetramethylpiperidin-4-yl)hydrazinyl]methanediamine;propan-1-amine |
|---|---|
| PubChem CID | 144771781 |
| Molecular Formula | C23H54N6 |
| Molecular Weight | 414.73 g/mol |
| Exact Mass | 414.44 |
| IUPAC Name | N',N'-dibutyl-1-[2-ethyl-2-(2,2,6,6-tetramethylpiperidin-4-yl)hydrazinyl]methanediamine;propan-1-amine |
| SMILES | CCCCN(CCCC)C(N)NN(CC)C1CC(C)(C)NC(C)(C)C1.CCCN |
| InChI | InChI=1S/C20H45N5.C3H9N/c1-8-11-13-24(14-12-9-2)18(21)22-25(10-3)17-15-19(4,5)23-20(6,7)16-17;1-2-3-4/h17-18,22-23H,8-16,21H2,1-7H3;2-4H2,1H3 |
| InChIKey | MFODOUOQEHTQLD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 82.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.73 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|