About ethane;1-[(3Z)-2-methylidenehexa-3,5-dienyl]cyclohexa-1,3-diene
ethane;1-[(3Z)-2-methylidenehexa-3,5-dienyl]cyclohexa-1,3-diene (PubChem CID 144772189) has the molecular formula C15H22
and a molecular weight of 202.34 g/mol. Its IUPAC name is ethane;1-[(3Z)-2-methylidenehexa-3,5-dienyl]cyclohexa-1,3-diene.
Molecular Properties
| Compound Name | ethane;1-[(3Z)-2-methylidenehexa-3,5-dienyl]cyclohexa-1,3-diene |
| PubChem CID | 144772189 |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | ethane;1-[(3Z)-2-methylidenehexa-3,5-dienyl]cyclohexa-1,3-diene |
| SMILES | C=C/C=C\C(=C)CC1=CC=CCC1.CC |
| InChI | InChI=1S/C13H16.C2H6/c1-3-4-8-12(2)11-13-9-6-5-7-10-13;1-2/h3-6,8-9H,1-2,7,10-11H2;1-2H3/b8-4-; |
| InChIKey | MMSUTZLDTLHSKG-ZYFYRQFPSA-N |
| XLogP | 4.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-[(3Z)-2-methylidenehexa-3,5-dienyl]cyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-[(3Z)-2-methylidenehexa-3,5-dienyl]cyclohexa-1,3-diene?
The IUPAC name of ethane;1-[(3Z)-2-methylidenehexa-3,5-dienyl]cyclohexa-1,3-diene (CID 144772189) is ethane;1-[(3Z)-2-methylidenehexa-3,5-dienyl]cyclohexa-1,3-diene.
What is the SMILES notation for ethane;1-[(3Z)-2-methylidenehexa-3,5-dienyl]cyclohexa-1,3-diene?
The canonical SMILES for ethane;1-[(3Z)-2-methylidenehexa-3,5-dienyl]cyclohexa-1,3-diene is C=C/C=C\C(=C)CC1=CC=CCC1.CC.
What is the InChIKey of ethane;1-[(3Z)-2-methylidenehexa-3,5-dienyl]cyclohexa-1,3-diene?
The InChIKey is MMSUTZLDTLHSKG-ZYFYRQFPSA-N. The full InChI is InChI=1S/C13H16.C2H6/c1-3-4-8-12(2)11-13-9-6-5-7-10-13;1-2/h3-6,8-9H,1-2,7,10-11H2;1-2H3/b8-4-;.
What are the key properties of ethane;1-[(3Z)-2-methylidenehexa-3,5-dienyl]cyclohexa-1,3-diene?
ethane;1-[(3Z)-2-methylidenehexa-3,5-dienyl]cyclohexa-1,3-diene has a molecular weight of 202.34 g/mol, XLogP of 4.98, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-[(3Z)-2-methylidenehexa-3,5-dienyl]cyclohexa-1,3-diene is sourced from PubChem (CID 144772189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).