About ethane;3-isocyanato-7-methyl-7-(trifluoromethyl)cyclohepta-1,3,5-triene
ethane;3-isocyanato-7-methyl-7-(trifluoromethyl)cyclohepta-1,3,5-triene (PubChem CID 144772314) has the molecular formula C12H14F3NO
and a molecular weight of 245.24 g/mol. Its IUPAC name is ethane;3-isocyanato-7-methyl-7-(trifluoromethyl)cyclohepta-1,3,5-triene.
Molecular Properties
| Compound Name | ethane;3-isocyanato-7-methyl-7-(trifluoromethyl)cyclohepta-1,3,5-triene |
| PubChem CID | 144772314 |
| Molecular Formula | C12H14F3NO |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | ethane;3-isocyanato-7-methyl-7-(trifluoromethyl)cyclohepta-1,3,5-triene |
| SMILES | CC.CC1(C(F)(F)F)C=CC=C(N=C=O)C=C1 |
| InChI | InChI=1S/C10H8F3NO.C2H6/c1-9(10(11,12)13)5-2-3-8(4-6-9)14-7-15;1-2/h2-6H,1H3;1-2H3 |
| InChIKey | GRAUBJJOVVSWBW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-isocyanato-7-methyl-7-(trifluoromethyl)cyclohepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-isocyanato-7-methyl-7-(trifluoromethyl)cyclohepta-1,3,5-triene?
The IUPAC name of ethane;3-isocyanato-7-methyl-7-(trifluoromethyl)cyclohepta-1,3,5-triene (CID 144772314) is ethane;3-isocyanato-7-methyl-7-(trifluoromethyl)cyclohepta-1,3,5-triene.
What is the SMILES notation for ethane;3-isocyanato-7-methyl-7-(trifluoromethyl)cyclohepta-1,3,5-triene?
The canonical SMILES for ethane;3-isocyanato-7-methyl-7-(trifluoromethyl)cyclohepta-1,3,5-triene is CC.CC1(C(F)(F)F)C=CC=C(N=C=O)C=C1.
What is the InChIKey of ethane;3-isocyanato-7-methyl-7-(trifluoromethyl)cyclohepta-1,3,5-triene?
The InChIKey is GRAUBJJOVVSWBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F3NO.C2H6/c1-9(10(11,12)13)5-2-3-8(4-6-9)14-7-15;1-2/h2-6H,1H3;1-2H3.
What are the key properties of ethane;3-isocyanato-7-methyl-7-(trifluoromethyl)cyclohepta-1,3,5-triene?
ethane;3-isocyanato-7-methyl-7-(trifluoromethyl)cyclohepta-1,3,5-triene has a molecular weight of 245.24 g/mol, XLogP of 3.93, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-isocyanato-7-methyl-7-(trifluoromethyl)cyclohepta-1,3,5-triene is sourced from PubChem (CID 144772314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).