C22H31NS — CID 144772315
(5E,6E)-2,3-bis(ethenyl)-4-ethyl-5,6-di(ethylidene)-1,4-thiazine;(3Z,4Z)-3-ethylidenehexa-1,4-diene (PubChem CID 144772315) has the molecular formula C22H31NS and a molecular weight of 341.56 g/mol. Its IUPAC name is (5E,6E)-2,3-bis(ethenyl)-4-ethyl-5,6-di(ethylidene)-1,4-thiazine;(3Z,4Z)-3-ethylidenehexa-1,4-diene.
| Compound Name | (5E,6E)-2,3-bis(ethenyl)-4-ethyl-5,6-di(ethylidene)-1,4-thiazine;(3Z,4Z)-3-ethylidenehexa-1,4-diene |
|---|---|
| PubChem CID | 144772315 |
| Molecular Formula | C22H31NS |
| Molecular Weight | 341.56 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | (5E,6E)-2,3-bis(ethenyl)-4-ethyl-5,6-di(ethylidene)-1,4-thiazine;(3Z,4Z)-3-ethylidenehexa-1,4-diene |
| SMILES | C=CC(/C=C\C)=C/C.C=CC1=C(C=C)N(CC)C(=C/C)/C(=C\C)S1 |
| InChI | InChI=1S/C14H19NS.C8H12/c1-6-11-13(8-3)16-14(9-4)12(7-2)15(11)10-5;1-4-7-8(5-2)6-3/h6-9H,1,3,10H2,2,4-5H3;4-7H,2H2,1,3H3/b12-7+,14-9+;7-4-,8-6- |
| InChIKey | QUVKVCFTTDHJNN-IQCQPPRASA-N |
| XLogP | 7.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.56 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|