C45H50O5 — CID 144772711
[4-[1-[4-[4-[4-[2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-methylphenoxy]-2,3,3-trimethylbutan-2-yl]oxyphenyl]-1-phenylethyl]phenyl] formate (PubChem CID 144772711) has the molecular formula C45H50O5 and a molecular weight of 670.89 g/mol. Its IUPAC name is [4-[1-[4-[4-[4-[2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-methylphenoxy]-2,3,3-trimethylbutan-2-yl]oxyphenyl]-1-phenylethyl]phenyl] formate.
| Compound Name | [4-[1-[4-[4-[4-[2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-methylphenoxy]-2,3,3-trimethylbutan-2-yl]oxyphenyl]-1-phenylethyl]phenyl] formate |
|---|---|
| PubChem CID | 144772711 |
| Molecular Formula | C45H50O5 |
| Molecular Weight | 670.89 g/mol |
| Exact Mass | 670.37 |
| IUPAC Name | [4-[1-[4-[4-[4-[2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-methylphenoxy]-2,3,3-trimethylbutan-2-yl]oxyphenyl]-1-phenylethyl]phenyl] formate |
| SMILES | Cc1cc(C(C)(C)c2ccc(OCC(C)(C)C(C)(C)Oc3ccc(C(C)(c4ccccc4)c4ccc(OC=O)cc4)cc3)c(C)c2)ccc1O |
| InChI | InChI=1S/C45H50O5/c1-31-27-36(19-25-40(31)47)43(5,6)37-20-26-41(32(2)28-37)48-29-42(3,4)44(7,8)50-39-23-17-35(18-24-39)45(9,33-13-11-10-12-14-33)34-15-21-38(22-16-34)49-30-46/h10-28,30,47H,29H2,1-9H3 |
| InChIKey | UPTLKGANQLSCRC-UHFFFAOYSA-N |
| XLogP | 10.49 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.89 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|