About 1-[(2S)-4,4-difluoro-2-methyloxolan-2-yl]ethanone;ethane
1-[(2S)-4,4-difluoro-2-methyloxolan-2-yl]ethanone;ethane (PubChem CID 144773592) has the molecular formula C9H16F2O2
and a molecular weight of 194.22 g/mol. Its IUPAC name is 1-[(2S)-4,4-difluoro-2-methyloxolan-2-yl]ethanone;ethane.
Molecular Properties
| Compound Name | 1-[(2S)-4,4-difluoro-2-methyloxolan-2-yl]ethanone;ethane |
| PubChem CID | 144773592 |
| Molecular Formula | C9H16F2O2 |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 1-[(2S)-4,4-difluoro-2-methyloxolan-2-yl]ethanone;ethane |
| SMILES | CC.CC(=O)[C@]1(C)CC(F)(F)CO1 |
| InChI | InChI=1S/C7H10F2O2.C2H6/c1-5(10)6(2)3-7(8,9)4-11-6;1-2/h3-4H2,1-2H3;1-2H3/t6-;/m0./s1 |
| InChIKey | MWDNKJCHZUOXLM-RGMNGODLSA-N |
| XLogP | 2.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(2S)-4,4-difluoro-2-methyloxolan-2-yl]ethanone;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S)-4,4-difluoro-2-methyloxolan-2-yl]ethanone;ethane?
The IUPAC name of 1-[(2S)-4,4-difluoro-2-methyloxolan-2-yl]ethanone;ethane (CID 144773592) is 1-[(2S)-4,4-difluoro-2-methyloxolan-2-yl]ethanone;ethane.
What is the SMILES notation for 1-[(2S)-4,4-difluoro-2-methyloxolan-2-yl]ethanone;ethane?
The canonical SMILES for 1-[(2S)-4,4-difluoro-2-methyloxolan-2-yl]ethanone;ethane is CC.CC(=O)[C@]1(C)CC(F)(F)CO1.
What is the InChIKey of 1-[(2S)-4,4-difluoro-2-methyloxolan-2-yl]ethanone;ethane?
The InChIKey is MWDNKJCHZUOXLM-RGMNGODLSA-N. The full InChI is InChI=1S/C7H10F2O2.C2H6/c1-5(10)6(2)3-7(8,9)4-11-6;1-2/h3-4H2,1-2H3;1-2H3/t6-;/m0./s1.
What are the key properties of 1-[(2S)-4,4-difluoro-2-methyloxolan-2-yl]ethanone;ethane?
1-[(2S)-4,4-difluoro-2-methyloxolan-2-yl]ethanone;ethane has a molecular weight of 194.22 g/mol, XLogP of 2.42, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S)-4,4-difluoro-2-methyloxolan-2-yl]ethanone;ethane is sourced from PubChem (CID 144773592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).