C52H48F3N5O — CID 144774057
N-[2-[benzyl(2-methylpropyl)amino]-5-[2-[(Z)-N'-(tritylamino)carbamimidoyl]phenyl]phenyl]-2-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 144774057) has the molecular formula C52H48F3N5O and a molecular weight of 815.98 g/mol. Its IUPAC name is N-[2-[benzyl(2-methylpropyl)amino]-5-[2-[(Z)-N'-(tritylamino)carbamimidoyl]phenyl]phenyl]-2-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[2-[benzyl(2-methylpropyl)amino]-5-[2-[(Z)-N'-(tritylamino)carbamimidoyl]phenyl]phenyl]-2-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 144774057 |
| Molecular Formula | C52H48F3N5O |
| Molecular Weight | 815.98 g/mol |
| Exact Mass | 815.38 |
| IUPAC Name | N-[2-[benzyl(2-methylpropyl)amino]-5-[2-[(Z)-N'-(tritylamino)carbamimidoyl]phenyl]phenyl]-2-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC(C)CN(Cc1ccccc1)c1ccc(-c2ccccc2/C(N)=N/NC(c2ccccc2)(c2ccccc2)c2ccccc2)cc1NC(=O)Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C52H48F3N5O/c1-37(2)35-60(36-38-19-7-3-8-20-38)48-32-31-39(33-47(48)57-49(61)34-40-21-15-18-30-46(40)52(53,54)55)44-28-16-17-29-45(44)50(56)58-59-51(41-22-9-4-10-23-41,42-24-11-5-12-25-42)43-26-13-6-14-27-43/h3-33,37,59H,34-36H2,1-2H3,(H2,56,58)(H,57,61) |
| InChIKey | JMNFOACUVKSWMG-UHFFFAOYSA-N |
| XLogP | 11.42 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.98 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|