C16H28 — CID 144774189
ethane;ethene;2-[(2R)-1,2,3-trimethylcyclopropyl]cyclohexa-1,3-diene (PubChem CID 144774189) has the molecular formula C16H28 and a molecular weight of 220.40 g/mol. Its IUPAC name is ethane;ethene;2-[(2R)-1,2,3-trimethylcyclopropyl]cyclohexa-1,3-diene.
| Compound Name | ethane;ethene;2-[(2R)-1,2,3-trimethylcyclopropyl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 144774189 |
| Molecular Formula | C16H28 |
| Molecular Weight | 220.40 g/mol |
| Exact Mass | 220.22 |
| IUPAC Name | ethane;ethene;2-[(2R)-1,2,3-trimethylcyclopropyl]cyclohexa-1,3-diene |
| SMILES | C=C.CC.CC1[C@@H](C)C1(C)C1=CCCC=C1 |
| InChI | InChI=1S/C12H18.C2H6.C2H4/c1-9-10(2)12(9,3)11-7-5-4-6-8-11;2*1-2/h5,7-10H,4,6H2,1-3H3;1-2H3;1-2H2/t9-,10?,12?;;/m1../s1 |
| InChIKey | CQNWDSRKFABVFE-CNDGEQJASA-N |
| XLogP | 5.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.40 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|