C13H26N2S — CID 144774242
ethane;2-methylidene-4-pentyl-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole (PubChem CID 144774242) has the molecular formula C13H26N2S and a molecular weight of 242.43 g/mol. Its IUPAC name is ethane;2-methylidene-4-pentyl-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole.
| Compound Name | ethane;2-methylidene-4-pentyl-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole |
|---|---|
| PubChem CID | 144774242 |
| Molecular Formula | C13H26N2S |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | ethane;2-methylidene-4-pentyl-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazole |
| SMILES | C=C1NC2CSC(CCCCC)C2N1.CC |
| InChI | InChI=1S/C11H20N2S.C2H6/c1-3-4-5-6-10-11-9(7-14-10)12-8(2)13-11;1-2/h9-13H,2-7H2,1H3;1-2H3 |
| InChIKey | HJFNBVQJOVWJBY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|