C14H21F3N2O5 — CID 144774365
(2,5-dioxopyrrolidin-1-yl) 6-[(2,2,2-trifluoroacetyl)amino]hexanoate;ethane (PubChem CID 144774365) has the molecular formula C14H21F3N2O5 and a molecular weight of 354.33 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[(2,2,2-trifluoroacetyl)amino]hexanoate;ethane.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[(2,2,2-trifluoroacetyl)amino]hexanoate;ethane |
|---|---|
| PubChem CID | 144774365 |
| Molecular Formula | C14H21F3N2O5 |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[(2,2,2-trifluoroacetyl)amino]hexanoate;ethane |
| SMILES | CC.O=C(CCCCCNC(=O)C(F)(F)F)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C12H15F3N2O5.C2H6/c13-12(14,15)11(21)16-7-3-1-2-4-10(20)22-17-8(18)5-6-9(17)19;1-2/h1-7H2,(H,16,21);1-2H3 |
| InChIKey | XETANHFAXHHOAU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|