C28H35IN6O4 — CID 144774475
N-[3-[2-[4-[ethyl-[3-(2-methoxyethyl)-1λ3,3-iodazolidin-1-yl]amino]anilino]-5-methoxypyrimidin-4-yl]oxyphenyl]prop-2-enamide (PubChem CID 144774475) has the molecular formula C28H35IN6O4 and a molecular weight of 646.53 g/mol. Its IUPAC name is N-[3-[2-[4-[ethyl-[3-(2-methoxyethyl)-1λ3,3-iodazolidin-1-yl]amino]anilino]-5-methoxypyrimidin-4-yl]oxyphenyl]prop-2-enamide.
| Compound Name | N-[3-[2-[4-[ethyl-[3-(2-methoxyethyl)-1λ3,3-iodazolidin-1-yl]amino]anilino]-5-methoxypyrimidin-4-yl]oxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 144774475 |
| Molecular Formula | C28H35IN6O4 |
| Molecular Weight | 646.53 g/mol |
| Exact Mass | 646.18 |
| IUPAC Name | N-[3-[2-[4-[ethyl-[3-(2-methoxyethyl)-1λ3,3-iodazolidin-1-yl]amino]anilino]-5-methoxypyrimidin-4-yl]oxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(N(CC)I4CCN(CCOC)C4)cc3)ncc2OC)c1 |
| InChI | InChI=1S/C28H35IN6O4/c1-5-26(36)31-22-8-7-9-24(18-22)39-27-25(38-4)19-30-28(33-27)32-21-10-12-23(13-11-21)35(6-2)29-14-15-34(20-29)16-17-37-3/h5,7-13,18-19H,1,6,14-17,20H2,2-4H3,(H,31,36)(H,30,32,33) |
| InChIKey | WGMKGFOKVSLQSV-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 101.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.53 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|