About 4-methyl-1-(2-methylpropyl)-5-phenylsulfanyl-2,3-dihydropyridin-4-ol
4-methyl-1-(2-methylpropyl)-5-phenylsulfanyl-2,3-dihydropyridin-4-ol (PubChem CID 144774562) has the molecular formula C16H23NOS
and a molecular weight of 277.43 g/mol. Its IUPAC name is 4-methyl-1-(2-methylpropyl)-5-phenylsulfanyl-2,3-dihydropyridin-4-ol.
Molecular Properties
| Compound Name | 4-methyl-1-(2-methylpropyl)-5-phenylsulfanyl-2,3-dihydropyridin-4-ol |
| PubChem CID | 144774562 |
| Molecular Formula | C16H23NOS |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 4-methyl-1-(2-methylpropyl)-5-phenylsulfanyl-2,3-dihydropyridin-4-ol |
| SMILES | CC(C)CN1C=C(Sc2ccccc2)C(C)(O)CC1 |
| InChI | InChI=1S/C16H23NOS/c1-13(2)11-17-10-9-16(3,18)15(12-17)19-14-7-5-4-6-8-14/h4-8,12-13,18H,9-11H2,1-3H3 |
| InChIKey | JEXDCYBJOQLBFD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-1-(2-methylpropyl)-5-phenylsulfanyl-2,3-dihydropyridin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1-(2-methylpropyl)-5-phenylsulfanyl-2,3-dihydropyridin-4-ol?
The IUPAC name of 4-methyl-1-(2-methylpropyl)-5-phenylsulfanyl-2,3-dihydropyridin-4-ol (CID 144774562) is 4-methyl-1-(2-methylpropyl)-5-phenylsulfanyl-2,3-dihydropyridin-4-ol.
What is the SMILES notation for 4-methyl-1-(2-methylpropyl)-5-phenylsulfanyl-2,3-dihydropyridin-4-ol?
The canonical SMILES for 4-methyl-1-(2-methylpropyl)-5-phenylsulfanyl-2,3-dihydropyridin-4-ol is CC(C)CN1C=C(Sc2ccccc2)C(C)(O)CC1.
What is the InChIKey of 4-methyl-1-(2-methylpropyl)-5-phenylsulfanyl-2,3-dihydropyridin-4-ol?
The InChIKey is JEXDCYBJOQLBFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NOS/c1-13(2)11-17-10-9-16(3,18)15(12-17)19-14-7-5-4-6-8-14/h4-8,12-13,18H,9-11H2,1-3H3.
What are the key properties of 4-methyl-1-(2-methylpropyl)-5-phenylsulfanyl-2,3-dihydropyridin-4-ol?
4-methyl-1-(2-methylpropyl)-5-phenylsulfanyl-2,3-dihydropyridin-4-ol has a molecular weight of 277.43 g/mol, XLogP of 3.73, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1-(2-methylpropyl)-5-phenylsulfanyl-2,3-dihydropyridin-4-ol is sourced from PubChem (CID 144774562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).