About CID 144774623
CID 144774623 (PubChem CID 144774623) has the molecular formula C16H24O2
and a molecular weight of 248.37 g/mol.
Molecular Properties
| Compound Name | CID 144774623 |
| PubChem CID | 144774623 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | — |
| SMILES | O=C(O)CC1CCC2(CC2)C2CCC3(CC3)C2C1 |
| InChI | InChI=1S/C16H24O2/c17-14(18)10-11-1-3-15(5-6-15)12-2-4-16(7-8-16)13(12)9-11/h11-13H,1-10H2,(H,17,18) |
| InChIKey | IGRQKUNRPIYTBH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 144774623 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 144774623?
The IUPAC name of CID 144774623 (CID 144774623) is not available.
What is the SMILES notation for CID 144774623?
The canonical SMILES for CID 144774623 is O=C(O)CC1CCC2(CC2)C2CCC3(CC3)C2C1.
What is the InChIKey of CID 144774623?
The InChIKey is IGRQKUNRPIYTBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O2/c17-14(18)10-11-1-3-15(5-6-15)12-2-4-16(7-8-16)13(12)9-11/h11-13H,1-10H2,(H,17,18).
What are the key properties of CID 144774623?
CID 144774623 has a molecular weight of 248.37 g/mol, XLogP of 3.85, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 144774623 is sourced from PubChem (CID 144774623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).