About CID 144774641
CID 144774641 (PubChem CID 144774641) has the molecular formula C23H35NO2
and a molecular weight of 357.54 g/mol.
Molecular Properties
| Compound Name | CID 144774641 |
| PubChem CID | 144774641 |
| Molecular Formula | C23H35NO2 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.27 |
| IUPAC Name | — |
| SMILES | CC1CCN(CC2C(=O)O[C@H]3C2CCC2(CC2)C2CCC4(CC4)C23)CC1 |
| InChI | InChI=1S/C23H35NO2/c1-15-4-12-24(13-5-15)14-17-16-2-6-22(8-9-22)18-3-7-23(10-11-23)19(18)20(16)26-21(17)25/h15-20H,2-14H2,1H3/t16?,17?,18?,19?,20-/m0/s1 |
| InChIKey | MPGVSMHHECTKJJ-CEVCPLMDSA-N |
| XLogP | 4.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 144774641 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 144774641?
The IUPAC name of CID 144774641 (CID 144774641) is not available.
What is the SMILES notation for CID 144774641?
The canonical SMILES for CID 144774641 is CC1CCN(CC2C(=O)O[C@H]3C2CCC2(CC2)C2CCC4(CC4)C23)CC1.
What is the InChIKey of CID 144774641?
The InChIKey is MPGVSMHHECTKJJ-CEVCPLMDSA-N. The full InChI is InChI=1S/C23H35NO2/c1-15-4-12-24(13-5-15)14-17-16-2-6-22(8-9-22)18-3-7-23(10-11-23)19(18)20(16)26-21(17)25/h15-20H,2-14H2,1H3/t16?,17?,18?,19?,20-/m0/s1.
What are the key properties of CID 144774641?
CID 144774641 has a molecular weight of 357.54 g/mol, XLogP of 4.26, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 144774641 is sourced from PubChem (CID 144774641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).