About acetylene;1-azabicyclo[2.2.2]octane
acetylene;1-azabicyclo[2.2.2]octane (PubChem CID 144774669) has the molecular formula C9H15N
and a molecular weight of 137.23 g/mol. Its IUPAC name is acetylene;1-azabicyclo[2.2.2]octane.
Molecular Properties
| Compound Name | acetylene;1-azabicyclo[2.2.2]octane |
| PubChem CID | 144774669 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | acetylene;1-azabicyclo[2.2.2]octane |
| SMILES | C#C.C1CN2CCC1CC2 |
| InChI | InChI=1S/C7H13N.C2H2/c1-4-8-5-2-7(1)3-6-8;1-2/h7H,1-6H2;1-2H |
| InChIKey | DDFYTKCUGUNXAI-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;1-azabicyclo[2.2.2]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;1-azabicyclo[2.2.2]octane?
The IUPAC name of acetylene;1-azabicyclo[2.2.2]octane (CID 144774669) is acetylene;1-azabicyclo[2.2.2]octane.
What is the SMILES notation for acetylene;1-azabicyclo[2.2.2]octane?
The canonical SMILES for acetylene;1-azabicyclo[2.2.2]octane is C#C.C1CN2CCC1CC2.
What is the InChIKey of acetylene;1-azabicyclo[2.2.2]octane?
The InChIKey is DDFYTKCUGUNXAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N.C2H2/c1-4-8-5-2-7(1)3-6-8;1-2/h7H,1-6H2;1-2H.
What are the key properties of acetylene;1-azabicyclo[2.2.2]octane?
acetylene;1-azabicyclo[2.2.2]octane has a molecular weight of 137.23 g/mol, XLogP of 1.35, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;1-azabicyclo[2.2.2]octane is sourced from PubChem (CID 144774669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).