C19H31N3O2 — CID 144774749
4-[2-[[cyclobutylidene-[(2-methylpropan-2-yl)oxy]methyl]amino]ethoxy]-2-N-ethylbenzene-1,2-diamine (PubChem CID 144774749) has the molecular formula C19H31N3O2 and a molecular weight of 333.48 g/mol. Its IUPAC name is 4-[2-[[cyclobutylidene-[(2-methylpropan-2-yl)oxy]methyl]amino]ethoxy]-2-N-ethylbenzene-1,2-diamine.
| Compound Name | 4-[2-[[cyclobutylidene-[(2-methylpropan-2-yl)oxy]methyl]amino]ethoxy]-2-N-ethylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 144774749 |
| Molecular Formula | C19H31N3O2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | 4-[2-[[cyclobutylidene-[(2-methylpropan-2-yl)oxy]methyl]amino]ethoxy]-2-N-ethylbenzene-1,2-diamine |
| SMILES | CCNc1cc(OCCNC(OC(C)(C)C)=C2CCC2)ccc1N |
| InChI | InChI=1S/C19H31N3O2/c1-5-21-17-13-15(9-10-16(17)20)23-12-11-22-18(14-7-6-8-14)24-19(2,3)4/h9-10,13,21-22H,5-8,11-12,20H2,1-4H3 |
| InChIKey | SESDLQXJMHWHLC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|