C46H38N4 — CID 144775645
N'-(N-benzyl-C-phenylcarbonimidoyl)-3-isoquinolin-7-yl-N-methylidene-5-[3,4,5-tris(ethenyl)-2-[(Z)-prop-1-enyl]phenyl]benzenecarboximidamide (PubChem CID 144775645) has the molecular formula C46H38N4 and a molecular weight of 646.84 g/mol. Its IUPAC name is N'-(N-benzyl-C-phenylcarbonimidoyl)-3-isoquinolin-7-yl-N-methylidene-5-[3,4,5-tris(ethenyl)-2-[(Z)-prop-1-enyl]phenyl]benzenecarboximidamide.
| Compound Name | N'-(N-benzyl-C-phenylcarbonimidoyl)-3-isoquinolin-7-yl-N-methylidene-5-[3,4,5-tris(ethenyl)-2-[(Z)-prop-1-enyl]phenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 144775645 |
| Molecular Formula | C46H38N4 |
| Molecular Weight | 646.84 g/mol |
| Exact Mass | 646.31 |
| IUPAC Name | N'-(N-benzyl-C-phenylcarbonimidoyl)-3-isoquinolin-7-yl-N-methylidene-5-[3,4,5-tris(ethenyl)-2-[(Z)-prop-1-enyl]phenyl]benzenecarboximidamide |
| SMILES | C=Cc1cc(-c2cc(/C(N=C)=N/C(=N/Cc3ccccc3)c3ccccc3)cc(-c3ccc4ccncc4c3)c2)c(/C=C\C)c(C=C)c1C=C |
| InChI | InChI=1S/C46H38N4/c1-6-16-43-42(9-4)41(8-3)33(7-2)29-44(43)38-26-37(36-22-21-34-23-24-48-31-40(34)25-36)27-39(28-38)45(47-5)50-46(35-19-14-11-15-20-35)49-30-32-17-12-10-13-18-32/h6-29,31H,2-5,30H2,1H3/b16-6-,49-46+,50-45- |
| InChIKey | QRXHGMAODCLVTG-RQXHGEFRSA-N |
| XLogP | 11.63 |
| TPSA | 49.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.84 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|