C22H24F3N2P — CID 144775822
(Z)-2-(methylamino)-3-[3-methyl-5-[(E)-2-(3-methylphenyl)ethenyl]phenyl]-3-phosphanylprop-2-enenitrile;1,1,1-trifluoroethane (PubChem CID 144775822) has the molecular formula C22H24F3N2P and a molecular weight of 404.42 g/mol. Its IUPAC name is (Z)-2-(methylamino)-3-[3-methyl-5-[(E)-2-(3-methylphenyl)ethenyl]phenyl]-3-phosphanylprop-2-enenitrile;1,1,1-trifluoroethane.
| Compound Name | (Z)-2-(methylamino)-3-[3-methyl-5-[(E)-2-(3-methylphenyl)ethenyl]phenyl]-3-phosphanylprop-2-enenitrile;1,1,1-trifluoroethane |
|---|---|
| PubChem CID | 144775822 |
| Molecular Formula | C22H24F3N2P |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | (Z)-2-(methylamino)-3-[3-methyl-5-[(E)-2-(3-methylphenyl)ethenyl]phenyl]-3-phosphanylprop-2-enenitrile;1,1,1-trifluoroethane |
| SMILES | CC(F)(F)F.CN/C(C#N)=C(\P)c1cc(C)cc(/C=C/c2cccc(C)c2)c1 |
| InChI | InChI=1S/C20H21N2P.C2H3F3/c1-14-5-4-6-16(9-14)7-8-17-10-15(2)11-18(12-17)20(23)19(13-21)22-3;1-2(3,4)5/h4-12,22H,23H2,1-3H3;1H3/b8-7+,20-19-; |
| InChIKey | ZHHUBXDGJONPHK-PNGBZGDWSA-N |
| XLogP | 6.33 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|