C23H22F4N2 — CID 144775866
acetylene;(E)-3-[3-[2-(4-fluorophenyl)ethyl]-5-(2,2,2-trifluoroethyl)phenyl]-2-(methylamino)but-2-enenitrile (PubChem CID 144775866) has the molecular formula C23H22F4N2 and a molecular weight of 402.44 g/mol. Its IUPAC name is acetylene;(E)-3-[3-[2-(4-fluorophenyl)ethyl]-5-(2,2,2-trifluoroethyl)phenyl]-2-(methylamino)but-2-enenitrile.
| Compound Name | acetylene;(E)-3-[3-[2-(4-fluorophenyl)ethyl]-5-(2,2,2-trifluoroethyl)phenyl]-2-(methylamino)but-2-enenitrile |
|---|---|
| PubChem CID | 144775866 |
| Molecular Formula | C23H22F4N2 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | acetylene;(E)-3-[3-[2-(4-fluorophenyl)ethyl]-5-(2,2,2-trifluoroethyl)phenyl]-2-(methylamino)but-2-enenitrile |
| SMILES | C#C.CN/C(C#N)=C(\C)c1cc(CCc2ccc(F)cc2)cc(CC(F)(F)F)c1 |
| InChI | InChI=1S/C21H20F4N2.C2H2/c1-14(20(13-26)27-2)18-10-16(9-17(11-18)12-21(23,24)25)4-3-15-5-7-19(22)8-6-15;1-2/h5-11,27H,3-4,12H2,1-2H3;1-2H/b20-14+; |
| InChIKey | DCPIXQFKOXRDJG-RANVTSCRSA-N |
| XLogP | 5.44 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|