C21H20F2N2 — CID 144775875
(2E)-3-[4-(2,5-difluoro-3,4-dimethylphenyl)phenyl]-4-methyl-2-(methylamino)penta-2,4-dienenitrile (PubChem CID 144775875) has the molecular formula C21H20F2N2 and a molecular weight of 338.40 g/mol. Its IUPAC name is (2E)-3-[4-(2,5-difluoro-3,4-dimethylphenyl)phenyl]-4-methyl-2-(methylamino)penta-2,4-dienenitrile.
| Compound Name | (2E)-3-[4-(2,5-difluoro-3,4-dimethylphenyl)phenyl]-4-methyl-2-(methylamino)penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 144775875 |
| Molecular Formula | C21H20F2N2 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | (2E)-3-[4-(2,5-difluoro-3,4-dimethylphenyl)phenyl]-4-methyl-2-(methylamino)penta-2,4-dienenitrile |
| SMILES | C=C(C)/C(=C(/C#N)NC)c1ccc(-c2cc(F)c(C)c(C)c2F)cc1 |
| InChI | InChI=1S/C21H20F2N2/c1-12(2)20(19(11-24)25-5)16-8-6-15(7-9-16)17-10-18(22)13(3)14(4)21(17)23/h6-10,25H,1H2,2-5H3/b20-19+ |
| InChIKey | XJWBGILOUWBQBU-FMQUCBEESA-N |
| XLogP | 5.28 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|