About 4-[(E)-2-(3,5-ditert-butylphenyl)ethenyl]cyclopenta-1,3-diene-1-carbaldehyde
4-[(E)-2-(3,5-ditert-butylphenyl)ethenyl]cyclopenta-1,3-diene-1-carbaldehyde (PubChem CID 144775934) has the molecular formula C22H28O
and a molecular weight of 308.46 g/mol. Its IUPAC name is 4-[(E)-2-(3,5-ditert-butylphenyl)ethenyl]cyclopenta-1,3-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 4-[(E)-2-(3,5-ditert-butylphenyl)ethenyl]cyclopenta-1,3-diene-1-carbaldehyde |
| PubChem CID | 144775934 |
| Molecular Formula | C22H28O |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 4-[(E)-2-(3,5-ditert-butylphenyl)ethenyl]cyclopenta-1,3-diene-1-carbaldehyde |
| SMILES | CC(C)(C)c1cc(/C=C/C2=CC=C(C=O)C2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H28O/c1-21(2,3)19-12-17(13-20(14-19)22(4,5)6)9-7-16-8-10-18(11-16)15-23/h7-10,12-15H,11H2,1-6H3/b9-7+ |
| InChIKey | JRXFNGJBNUKSAL-VQHVLOKHSA-N |
| XLogP | 5.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-2-(3,5-ditert-butylphenyl)ethenyl]cyclopenta-1,3-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-2-(3,5-ditert-butylphenyl)ethenyl]cyclopenta-1,3-diene-1-carbaldehyde?
The IUPAC name of 4-[(E)-2-(3,5-ditert-butylphenyl)ethenyl]cyclopenta-1,3-diene-1-carbaldehyde (CID 144775934) is 4-[(E)-2-(3,5-ditert-butylphenyl)ethenyl]cyclopenta-1,3-diene-1-carbaldehyde.
What is the SMILES notation for 4-[(E)-2-(3,5-ditert-butylphenyl)ethenyl]cyclopenta-1,3-diene-1-carbaldehyde?
The canonical SMILES for 4-[(E)-2-(3,5-ditert-butylphenyl)ethenyl]cyclopenta-1,3-diene-1-carbaldehyde is CC(C)(C)c1cc(/C=C/C2=CC=C(C=O)C2)cc(C(C)(C)C)c1.
What is the InChIKey of 4-[(E)-2-(3,5-ditert-butylphenyl)ethenyl]cyclopenta-1,3-diene-1-carbaldehyde?
The InChIKey is JRXFNGJBNUKSAL-VQHVLOKHSA-N. The full InChI is InChI=1S/C22H28O/c1-21(2,3)19-12-17(13-20(14-19)22(4,5)6)9-7-16-8-10-18(11-16)15-23/h7-10,12-15H,11H2,1-6H3/b9-7+.
What are the key properties of 4-[(E)-2-(3,5-ditert-butylphenyl)ethenyl]cyclopenta-1,3-diene-1-carbaldehyde?
4-[(E)-2-(3,5-ditert-butylphenyl)ethenyl]cyclopenta-1,3-diene-1-carbaldehyde has a molecular weight of 308.46 g/mol, XLogP of 5.75, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-2-(3,5-ditert-butylphenyl)ethenyl]cyclopenta-1,3-diene-1-carbaldehyde is sourced from PubChem (CID 144775934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).