About (2E)-2-(methylamino)-3-[3-[(E)-2-pyridin-2-ylethenyl]phenyl]penta-2,4-dienenitrile
(2E)-2-(methylamino)-3-[3-[(E)-2-pyridin-2-ylethenyl]phenyl]penta-2,4-dienenitrile (PubChem CID 144776287) has the molecular formula C19H17N3
and a molecular weight of 287.37 g/mol. Its IUPAC name is (2E)-2-(methylamino)-3-[3-[(E)-2-pyridin-2-ylethenyl]phenyl]penta-2,4-dienenitrile.
Molecular Properties
| Compound Name | (2E)-2-(methylamino)-3-[3-[(E)-2-pyridin-2-ylethenyl]phenyl]penta-2,4-dienenitrile |
| PubChem CID | 144776287 |
| Molecular Formula | C19H17N3 |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | (2E)-2-(methylamino)-3-[3-[(E)-2-pyridin-2-ylethenyl]phenyl]penta-2,4-dienenitrile |
| SMILES | C=C/C(=C(/C#N)NC)c1cccc(/C=C/c2ccccn2)c1 |
| InChI | InChI=1S/C19H17N3/c1-3-18(19(14-20)21-2)16-8-6-7-15(13-16)10-11-17-9-4-5-12-22-17/h3-13,21H,1H2,2H3/b11-10+,19-18+ |
| InChIKey | YSUNGOQRKRYGRM-ZSTJXTSSSA-N |
| XLogP | 3.89 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-(methylamino)-3-[3-[(E)-2-pyridin-2-ylethenyl]phenyl]penta-2,4-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-(methylamino)-3-[3-[(E)-2-pyridin-2-ylethenyl]phenyl]penta-2,4-dienenitrile?
The IUPAC name of (2E)-2-(methylamino)-3-[3-[(E)-2-pyridin-2-ylethenyl]phenyl]penta-2,4-dienenitrile (CID 144776287) is (2E)-2-(methylamino)-3-[3-[(E)-2-pyridin-2-ylethenyl]phenyl]penta-2,4-dienenitrile.
What is the SMILES notation for (2E)-2-(methylamino)-3-[3-[(E)-2-pyridin-2-ylethenyl]phenyl]penta-2,4-dienenitrile?
The canonical SMILES for (2E)-2-(methylamino)-3-[3-[(E)-2-pyridin-2-ylethenyl]phenyl]penta-2,4-dienenitrile is C=C/C(=C(/C#N)NC)c1cccc(/C=C/c2ccccn2)c1.
What is the InChIKey of (2E)-2-(methylamino)-3-[3-[(E)-2-pyridin-2-ylethenyl]phenyl]penta-2,4-dienenitrile?
The InChIKey is YSUNGOQRKRYGRM-ZSTJXTSSSA-N. The full InChI is InChI=1S/C19H17N3/c1-3-18(19(14-20)21-2)16-8-6-7-15(13-16)10-11-17-9-4-5-12-22-17/h3-13,21H,1H2,2H3/b11-10+,19-18+.
What are the key properties of (2E)-2-(methylamino)-3-[3-[(E)-2-pyridin-2-ylethenyl]phenyl]penta-2,4-dienenitrile?
(2E)-2-(methylamino)-3-[3-[(E)-2-pyridin-2-ylethenyl]phenyl]penta-2,4-dienenitrile has a molecular weight of 287.37 g/mol, XLogP of 3.89, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-(methylamino)-3-[3-[(E)-2-pyridin-2-ylethenyl]phenyl]penta-2,4-dienenitrile is sourced from PubChem (CID 144776287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).