C28H33F4N — CID 144777179
acetylene;(Z)-3-[3-[[3,5-bis(1,1-difluoroethyl)phenyl]methyl]-5-methylphenyl]-2-methylbut-2-enenitrile;propane (PubChem CID 144777179) has the molecular formula C28H33F4N and a molecular weight of 459.57 g/mol. Its IUPAC name is acetylene;(Z)-3-[3-[[3,5-bis(1,1-difluoroethyl)phenyl]methyl]-5-methylphenyl]-2-methylbut-2-enenitrile;propane.
| Compound Name | acetylene;(Z)-3-[3-[[3,5-bis(1,1-difluoroethyl)phenyl]methyl]-5-methylphenyl]-2-methylbut-2-enenitrile;propane |
|---|---|
| PubChem CID | 144777179 |
| Molecular Formula | C28H33F4N |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | acetylene;(Z)-3-[3-[[3,5-bis(1,1-difluoroethyl)phenyl]methyl]-5-methylphenyl]-2-methylbut-2-enenitrile;propane |
| SMILES | C#C.C/C(C#N)=C(\C)c1cc(C)cc(Cc2cc(C(C)(F)F)cc(C(C)(F)F)c2)c1.CCC |
| InChI | InChI=1S/C23H23F4N.C3H8.C2H2/c1-14-6-17(9-19(7-14)16(3)15(2)13-28)8-18-10-20(22(4,24)25)12-21(11-18)23(5,26)27;1-3-2;1-2/h6-7,9-12H,8H2,1-5H3;3H2,1-2H3;1-2H/b16-15-;; |
| InChIKey | ALPABBVMNVPQRF-NDXGFPCWSA-N |
| XLogP | 8.79 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|