C27H32N6O3 — CID 144777651
2-ethoxyacetaldehyde;2-[(4-methylpiperazin-1-yl)methyl]-6-[[5-(1H-pyrazol-5-yl)-2-pyridinyl]oxy]quinoline (PubChem CID 144777651) has the molecular formula C27H32N6O3 and a molecular weight of 488.59 g/mol. Its IUPAC name is 2-ethoxyacetaldehyde;2-[(4-methylpiperazin-1-yl)methyl]-6-[[5-(1H-pyrazol-5-yl)-2-pyridinyl]oxy]quinoline.
| Compound Name | 2-ethoxyacetaldehyde;2-[(4-methylpiperazin-1-yl)methyl]-6-[[5-(1H-pyrazol-5-yl)-2-pyridinyl]oxy]quinoline |
|---|---|
| PubChem CID | 144777651 |
| Molecular Formula | C27H32N6O3 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | 2-ethoxyacetaldehyde;2-[(4-methylpiperazin-1-yl)methyl]-6-[[5-(1H-pyrazol-5-yl)-2-pyridinyl]oxy]quinoline |
| SMILES | CCOCC=O.CN1CCN(Cc2ccc3cc(Oc4ccc(-c5ccn[nH]5)cn4)ccc3n2)CC1 |
| InChI | InChI=1S/C23H24N6O.C4H8O2/c1-28-10-12-29(13-11-28)16-19-4-2-17-14-20(5-6-21(17)26-19)30-23-7-3-18(15-24-23)22-8-9-25-27-22;1-2-6-4-3-5/h2-9,14-15H,10-13,16H2,1H3,(H,25,27);3H,2,4H2,1H3 |
| InChIKey | DKIGYKTUDONQIY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 96.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|