About 1-[(3Z)-3-(4-tert-butylphenyl)penta-1,3-dien-2-yl]-2,4-dimethylbenzene;but-1-yne;ethane
1-[(3Z)-3-(4-tert-butylphenyl)penta-1,3-dien-2-yl]-2,4-dimethylbenzene;but-1-yne;ethane (PubChem CID 144777957) has the molecular formula C29H40
and a molecular weight of 388.64 g/mol. Its IUPAC name is 1-[(3Z)-3-(4-tert-butylphenyl)penta-1,3-dien-2-yl]-2,4-dimethylbenzene;but-1-yne;ethane.
Molecular Properties
| Compound Name | 1-[(3Z)-3-(4-tert-butylphenyl)penta-1,3-dien-2-yl]-2,4-dimethylbenzene;but-1-yne;ethane |
| PubChem CID | 144777957 |
| Molecular Formula | C29H40 |
| Molecular Weight | 388.64 g/mol |
| Exact Mass | 388.31 |
| IUPAC Name | 1-[(3Z)-3-(4-tert-butylphenyl)penta-1,3-dien-2-yl]-2,4-dimethylbenzene;but-1-yne;ethane |
| SMILES | C#CCC.C=C(/C(=C\C)c1ccc(C(C)(C)C)cc1)c1ccc(C)cc1C.CC |
| InChI | InChI=1S/C23H28.C4H6.C2H6/c1-8-21(18(4)22-14-9-16(2)15-17(22)3)19-10-12-20(13-11-19)23(5,6)7;1-3-4-2;1-2/h8-15H,4H2,1-3,5-7H3;1H,4H2,2H3;1-2H3/b21-8+;; |
| InChIKey | KMKDDGPOKCWHMP-NKKZPMODSA-N |
| XLogP | 8.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.64 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3Z)-3-(4-tert-butylphenyl)penta-1,3-dien-2-yl]-2,4-dimethylbenzene;but-1-yne;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3Z)-3-(4-tert-butylphenyl)penta-1,3-dien-2-yl]-2,4-dimethylbenzene;but-1-yne;ethane?
The IUPAC name of 1-[(3Z)-3-(4-tert-butylphenyl)penta-1,3-dien-2-yl]-2,4-dimethylbenzene;but-1-yne;ethane (CID 144777957) is 1-[(3Z)-3-(4-tert-butylphenyl)penta-1,3-dien-2-yl]-2,4-dimethylbenzene;but-1-yne;ethane.
What is the SMILES notation for 1-[(3Z)-3-(4-tert-butylphenyl)penta-1,3-dien-2-yl]-2,4-dimethylbenzene;but-1-yne;ethane?
The canonical SMILES for 1-[(3Z)-3-(4-tert-butylphenyl)penta-1,3-dien-2-yl]-2,4-dimethylbenzene;but-1-yne;ethane is C#CCC.C=C(/C(=C\C)c1ccc(C(C)(C)C)cc1)c1ccc(C)cc1C.CC.
What is the InChIKey of 1-[(3Z)-3-(4-tert-butylphenyl)penta-1,3-dien-2-yl]-2,4-dimethylbenzene;but-1-yne;ethane?
The InChIKey is KMKDDGPOKCWHMP-NKKZPMODSA-N. The full InChI is InChI=1S/C23H28.C4H6.C2H6/c1-8-21(18(4)22-14-9-16(2)15-17(22)3)19-10-12-20(13-11-19)23(5,6)7;1-3-4-2;1-2/h8-15H,4H2,1-3,5-7H3;1H,4H2,2H3;1-2H3/b21-8+;;.
What are the key properties of 1-[(3Z)-3-(4-tert-butylphenyl)penta-1,3-dien-2-yl]-2,4-dimethylbenzene;but-1-yne;ethane?
1-[(3Z)-3-(4-tert-butylphenyl)penta-1,3-dien-2-yl]-2,4-dimethylbenzene;but-1-yne;ethane has a molecular weight of 388.64 g/mol, XLogP of 8.77, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3Z)-3-(4-tert-butylphenyl)penta-1,3-dien-2-yl]-2,4-dimethylbenzene;but-1-yne;ethane is sourced from PubChem (CID 144777957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).