About 1-ethyl-4,4-difluoro-5-oxopyrrolidine-2-carbaldehyde;fluoromethane
1-ethyl-4,4-difluoro-5-oxopyrrolidine-2-carbaldehyde;fluoromethane (PubChem CID 144778353) has the molecular formula C8H12F3NO2
and a molecular weight of 211.18 g/mol. Its IUPAC name is 1-ethyl-4,4-difluoro-5-oxopyrrolidine-2-carbaldehyde;fluoromethane.
Molecular Properties
| Compound Name | 1-ethyl-4,4-difluoro-5-oxopyrrolidine-2-carbaldehyde;fluoromethane |
| PubChem CID | 144778353 |
| Molecular Formula | C8H12F3NO2 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 1-ethyl-4,4-difluoro-5-oxopyrrolidine-2-carbaldehyde;fluoromethane |
| SMILES | CCN1C(=O)C(F)(F)CC1C=O.CF |
| InChI | InChI=1S/C7H9F2NO2.CH3F/c1-2-10-5(4-11)3-7(8,9)6(10)12;1-2/h4-5H,2-3H2,1H3;1H3 |
| InChIKey | CTLVGNXZHCQSHT-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-4,4-difluoro-5-oxopyrrolidine-2-carbaldehyde;fluoromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4,4-difluoro-5-oxopyrrolidine-2-carbaldehyde;fluoromethane?
The IUPAC name of 1-ethyl-4,4-difluoro-5-oxopyrrolidine-2-carbaldehyde;fluoromethane (CID 144778353) is 1-ethyl-4,4-difluoro-5-oxopyrrolidine-2-carbaldehyde;fluoromethane.
What is the SMILES notation for 1-ethyl-4,4-difluoro-5-oxopyrrolidine-2-carbaldehyde;fluoromethane?
The canonical SMILES for 1-ethyl-4,4-difluoro-5-oxopyrrolidine-2-carbaldehyde;fluoromethane is CCN1C(=O)C(F)(F)CC1C=O.CF.
What is the InChIKey of 1-ethyl-4,4-difluoro-5-oxopyrrolidine-2-carbaldehyde;fluoromethane?
The InChIKey is CTLVGNXZHCQSHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F2NO2.CH3F/c1-2-10-5(4-11)3-7(8,9)6(10)12;1-2/h4-5H,2-3H2,1H3;1H3.
What are the key properties of 1-ethyl-4,4-difluoro-5-oxopyrrolidine-2-carbaldehyde;fluoromethane?
1-ethyl-4,4-difluoro-5-oxopyrrolidine-2-carbaldehyde;fluoromethane has a molecular weight of 211.18 g/mol, XLogP of 1.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4,4-difluoro-5-oxopyrrolidine-2-carbaldehyde;fluoromethane is sourced from PubChem (CID 144778353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).