C14H26N2 — CID 144778371
ethane;N-[(1Z)-3-(1-ethylpiperidin-3-yl)buta-1,3-dienyl]methanimine (PubChem CID 144778371) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is ethane;N-[(1Z)-3-(1-ethylpiperidin-3-yl)buta-1,3-dienyl]methanimine.
| Compound Name | ethane;N-[(1Z)-3-(1-ethylpiperidin-3-yl)buta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 144778371 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | ethane;N-[(1Z)-3-(1-ethylpiperidin-3-yl)buta-1,3-dienyl]methanimine |
| SMILES | C=N/C=C\C(=C)C1CCCN(CC)C1.CC |
| InChI | InChI=1S/C12H20N2.C2H6/c1-4-14-9-5-6-12(10-14)11(2)7-8-13-3;1-2/h7-8,12H,2-6,9-10H2,1H3;1-2H3/b8-7-; |
| InChIKey | PMFQSYCYHANDGI-CFYXSCKTSA-N |
| XLogP | 3.52 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|