C10H16F3N3O2 — CID 144778765
ethane;N-[[2-methyl-3-oxo-5-(trifluoromethyl)-1H-pyrazol-4-yl]methyl]acetamide (PubChem CID 144778765) has the molecular formula C10H16F3N3O2 and a molecular weight of 267.25 g/mol. Its IUPAC name is ethane;N-[[2-methyl-3-oxo-5-(trifluoromethyl)-1H-pyrazol-4-yl]methyl]acetamide.
| Compound Name | ethane;N-[[2-methyl-3-oxo-5-(trifluoromethyl)-1H-pyrazol-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 144778765 |
| Molecular Formula | C10H16F3N3O2 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | ethane;N-[[2-methyl-3-oxo-5-(trifluoromethyl)-1H-pyrazol-4-yl]methyl]acetamide |
| SMILES | CC.CC(=O)NCc1c(C(F)(F)F)[nH]n(C)c1=O |
| InChI | InChI=1S/C8H10F3N3O2.C2H6/c1-4(15)12-3-5-6(8(9,10)11)13-14(2)7(5)16;1-2/h13H,3H2,1-2H3,(H,12,15);1-2H3 |
| InChIKey | PJZVBYFMJAQJQC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |