C10H22N2O — CID 144778775
ethane;1-hydroxy-4-methyl-2,3,3a,4,5,6,7,7a-octahydropyrrolo[3,2-c]pyridine (PubChem CID 144778775) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is ethane;1-hydroxy-4-methyl-2,3,3a,4,5,6,7,7a-octahydropyrrolo[3,2-c]pyridine.
| Compound Name | ethane;1-hydroxy-4-methyl-2,3,3a,4,5,6,7,7a-octahydropyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 144778775 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | ethane;1-hydroxy-4-methyl-2,3,3a,4,5,6,7,7a-octahydropyrrolo[3,2-c]pyridine |
| SMILES | CC.CC1NCCC2C1CCN2O |
| InChI | InChI=1S/C8H16N2O.C2H6/c1-6-7-3-5-10(11)8(7)2-4-9-6;1-2/h6-9,11H,2-5H2,1H3;1-2H3 |
| InChIKey | VWUULQKLEKIWCI-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |