C29H49NO5 — CID 14477894
[8-[7-(butylamino)-3,5-dihydroxy-7-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate (PubChem CID 14477894) has the molecular formula C29H49NO5 and a molecular weight of 491.71 g/mol. Its IUPAC name is [8-[7-(butylamino)-3,5-dihydroxy-7-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate.
| Compound Name | [8-[7-(butylamino)-3,5-dihydroxy-7-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 14477894 |
| Molecular Formula | C29H49NO5 |
| Molecular Weight | 491.71 g/mol |
| Exact Mass | 491.36 |
| IUPAC Name | [8-[7-(butylamino)-3,5-dihydroxy-7-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
| SMILES | CCCCNC(=O)CC(O)CC(O)CCC1C(C)C=CC2=CC(C)CC(OC(=O)C(C)(C)CC)C21 |
| InChI | InChI=1S/C29H49NO5/c1-7-9-14-30-26(33)18-23(32)17-22(31)12-13-24-20(4)10-11-21-15-19(3)16-25(27(21)24)35-28(34)29(5,6)8-2/h10-11,15,19-20,22-25,27,31-32H,7-9,12-14,16-18H2,1-6H3,(H,30,33) |
| InChIKey | SGDYTJKPCXIXQU-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.71 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|