C25H18BrF3N2O2S3 — CID 144779010
4-[[[4-bromo-3-(trifluoromethyl)phenyl]-methylidene-oxo-λ6-sulfanyl]amino]-2-(5,6-dihydro-1,3-benzothiazol-2-ylsulfanyl)naphthalen-1-ol (PubChem CID 144779010) has the molecular formula C25H18BrF3N2O2S3 and a molecular weight of 611.53 g/mol. Its IUPAC name is 4-[[[4-bromo-3-(trifluoromethyl)phenyl]-methylidene-oxo-λ6-sulfanyl]amino]-2-(5,6-dihydro-1,3-benzothiazol-2-ylsulfanyl)naphthalen-1-ol.
| Compound Name | 4-[[[4-bromo-3-(trifluoromethyl)phenyl]-methylidene-oxo-λ6-sulfanyl]amino]-2-(5,6-dihydro-1,3-benzothiazol-2-ylsulfanyl)naphthalen-1-ol |
|---|---|
| PubChem CID | 144779010 |
| Molecular Formula | C25H18BrF3N2O2S3 |
| Molecular Weight | 611.53 g/mol |
| Exact Mass | 609.97 |
| IUPAC Name | 4-[[[4-bromo-3-(trifluoromethyl)phenyl]-methylidene-oxo-λ6-sulfanyl]amino]-2-(5,6-dihydro-1,3-benzothiazol-2-ylsulfanyl)naphthalen-1-ol |
| SMILES | C=S(=O)(Nc1cc(Sc2nc3c(s2)=CCCC=3)c(O)c2ccccc12)c1ccc(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H18BrF3N2O2S3/c1-36(33,14-10-11-18(26)17(12-14)25(27,28)29)31-20-13-22(23(32)16-7-3-2-6-15(16)20)35-24-30-19-8-4-5-9-21(19)34-24/h2-3,6-13,32H,1,4-5H2,(H,31,33) |
| InChIKey | PGACPHOGXMFEEY-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.53 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|