C13H13F3N2O2 — CID 144779420
N-(3,3-difluorocyclobutyl)-2-(3-fluoro-N-formylanilino)acetamide (PubChem CID 144779420) has the molecular formula C13H13F3N2O2 and a molecular weight of 286.25 g/mol. Its IUPAC name is N-(3,3-difluorocyclobutyl)-2-(3-fluoro-N-formylanilino)acetamide.
| Compound Name | N-(3,3-difluorocyclobutyl)-2-(3-fluoro-N-formylanilino)acetamide |
|---|---|
| PubChem CID | 144779420 |
| Molecular Formula | C13H13F3N2O2 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | N-(3,3-difluorocyclobutyl)-2-(3-fluoro-N-formylanilino)acetamide |
| SMILES | O=CN(CC(=O)NC1CC(F)(F)C1)c1cccc(F)c1 |
| InChI | InChI=1S/C13H13F3N2O2/c14-9-2-1-3-11(4-9)18(8-19)7-12(20)17-10-5-13(15,16)6-10/h1-4,8,10H,5-7H2,(H,17,20) |
| InChIKey | JXMQIVKAXOCNSQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|