C25H30N2O2 — CID 144780777
[(3R,4R)-2,2,3,9-tetramethyl-4-(2-phenylethylamino)-3,4-dihydropyrano[2,3-g]quinolin-7-yl]methanol (PubChem CID 144780777) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is [(3R,4R)-2,2,3,9-tetramethyl-4-(2-phenylethylamino)-3,4-dihydropyrano[2,3-g]quinolin-7-yl]methanol.
| Compound Name | [(3R,4R)-2,2,3,9-tetramethyl-4-(2-phenylethylamino)-3,4-dihydropyrano[2,3-g]quinolin-7-yl]methanol |
|---|---|
| PubChem CID | 144780777 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | [(3R,4R)-2,2,3,9-tetramethyl-4-(2-phenylethylamino)-3,4-dihydropyrano[2,3-g]quinolin-7-yl]methanol |
| SMILES | Cc1cc(CO)nc2cc3c(cc12)OC(C)(C)[C@H](C)[C@H]3NCCc1ccccc1 |
| InChI | InChI=1S/C25H30N2O2/c1-16-12-19(15-28)27-22-13-21-23(14-20(16)22)29-25(3,4)17(2)24(21)26-11-10-18-8-6-5-7-9-18/h5-9,12-14,17,24,26,28H,10-11,15H2,1-4H3/t17-,24-/m1/s1 |
| InChIKey | QYVJMDZDTLYGJL-MZNJEOGPSA-N |
| XLogP | 4.72 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |