C15H26 — CID 144781203
(2R)-2-hexa-1,5-dien-2-yl-1,1,3-trimethylcyclohexane (PubChem CID 144781203) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is (2R)-2-hexa-1,5-dien-2-yl-1,1,3-trimethylcyclohexane.
| Compound Name | (2R)-2-hexa-1,5-dien-2-yl-1,1,3-trimethylcyclohexane |
|---|---|
| PubChem CID | 144781203 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | (2R)-2-hexa-1,5-dien-2-yl-1,1,3-trimethylcyclohexane |
| SMILES | C=CCCC(=C)[C@@H]1C(C)CCCC1(C)C |
| InChI | InChI=1S/C15H26/c1-6-7-9-12(2)14-13(3)10-8-11-15(14,4)5/h6,13-14H,1-2,7-11H2,3-5H3/t13?,14-/m1/s1 |
| InChIKey | SRPKCAYKBCPRAQ-ARLHGKGLSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|