C8H12Br3NO — CID 144781335
2,3,5-tribromo-2,6,6-trimethylpiperidin-4-one (PubChem CID 144781335) has the molecular formula C8H12Br3NO and a molecular weight of 377.90 g/mol. Its IUPAC name is 2,3,5-tribromo-2,6,6-trimethylpiperidin-4-one.
| Compound Name | 2,3,5-tribromo-2,6,6-trimethylpiperidin-4-one |
|---|---|
| PubChem CID | 144781335 |
| Molecular Formula | C8H12Br3NO |
| Molecular Weight | 377.90 g/mol |
| Exact Mass | 374.85 |
| IUPAC Name | 2,3,5-tribromo-2,6,6-trimethylpiperidin-4-one |
| SMILES | CC1(C)NC(C)(Br)C(Br)C(=O)C1Br |
| InChI | InChI=1S/C8H12Br3NO/c1-7(2)5(9)4(13)6(10)8(3,11)12-7/h5-6,12H,1-3H3 |
| InChIKey | KPMQBMSKHTXLAE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.90 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|