C32H28F4N2OS — CID 144781556
3-(3,5-difluorophenyl)-N-[3-fluoro-2-[2-[1-(4-methylphenyl)sulfanylaziridin-2-yl]ethyl]phenyl]-3-(4-fluorophenyl)propanamide (PubChem CID 144781556) has the molecular formula C32H28F4N2OS and a molecular weight of 564.65 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-N-[3-fluoro-2-[2-[1-(4-methylphenyl)sulfanylaziridin-2-yl]ethyl]phenyl]-3-(4-fluorophenyl)propanamide.
| Compound Name | 3-(3,5-difluorophenyl)-N-[3-fluoro-2-[2-[1-(4-methylphenyl)sulfanylaziridin-2-yl]ethyl]phenyl]-3-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 144781556 |
| Molecular Formula | C32H28F4N2OS |
| Molecular Weight | 564.65 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | 3-(3,5-difluorophenyl)-N-[3-fluoro-2-[2-[1-(4-methylphenyl)sulfanylaziridin-2-yl]ethyl]phenyl]-3-(4-fluorophenyl)propanamide |
| SMILES | Cc1ccc(SN2CC2CCc2c(F)cccc2NC(=O)CC(c2ccc(F)cc2)c2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C32H28F4N2OS/c1-20-5-12-27(13-6-20)40-38-19-26(38)11-14-28-30(36)3-2-4-31(28)37-32(39)18-29(21-7-9-23(33)10-8-21)22-15-24(34)17-25(35)16-22/h2-10,12-13,15-17,26,29H,11,14,18-19H2,1H3,(H,37,39) |
| InChIKey | ZAUWTMPHRNHSDP-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 32.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.65 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|